ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluoro-3-methylbenzoic acid |
|
उत्पाद का नाम | 4-Fluoro-3-methylbenzoic acid |
अंग्रेज | 4-Fluoro-3-methylbenzoic acid;4-Fluoro-m-toluic acid;4-fluoro-3-methylbenzoate;3-methyl-4-Fluorobenzoic acid; |
आणविक फार्मूला | C8H6FO2 |
आण्विक वजन | 153.131 |
InChI | InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
कैस रजिस्टी संख्या | 403-15-6 |
आणविक संरचना | |
गलनांक | 166-169℃ |
उबलने का समय | 266.3°C at 760 mmHg |
फ्लैश प्वाइंट | 114.9°C |
वाष्प का दबाव | 0.00434mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |