ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(3-fluorophenyl)ethanol |
|
उत्पाद का नाम | 1-(3-fluorophenyl)ethanol |
अंग्रेज | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
आणविक फार्मूला | C8H9FO |
आण्विक वजन | 140.1549 |
InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
कैस रजिस्टी संख्या | 402-63-1 |
EINECS | 206-950-4 |
आणविक संरचना | |
घनत्व | 1.123g/cm3 |
उबलने का समय | 196.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.51 |
फ्लैश प्वाइंट | 90.1°C |
वाष्प का दबाव | 0.251mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |