ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
ethylchlorofluoroacetate |
|
उत्पाद का नाम | ethylchlorofluoroacetate |
अंग्रेज | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
आणविक फार्मूला | C4H6ClFO2 |
आण्विक वजन | 140.5406 |
InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
कैस रजिस्टी संख्या | 401-56-9 |
EINECS | 206-930-5 |
आणविक संरचना | |
घनत्व | 1.219g/cm3 |
उबलने का समय | 129°C at 760 mmHg |
अपवर्तक सूचकांक | 1.39 |
फ्लैश प्वाइंट | 44.3°C |
वाष्प का दबाव | 10.4mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |