ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4004-95-9 1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड |
|
उत्पाद का नाम | 1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड |
समानार्थी | 1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड; 1-फेनिलपाइपरज़ीन एचसीएल |
अंग्रेज | 1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride;1-Phenylpiperazine HCl |
आणविक फार्मूला | C10H16Cl2N2 |
आण्विक वजन | 235.1534 |
InChI | InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
कैस रजिस्टी संख्या | 4004-95-9 |
EINECS | 223-654-0 |
आणविक संरचना | |
उबलने का समय | 287.2°C at 760 mmHg |
फ्लैश प्वाइंट | 138.3°C |
वाष्प का दबाव | 0.00252mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |