ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
388088-83-3 2-ब्रोमो-1- (3,5-डाइमिथाइल-1-बेंजोथियोफेन-2-वाईएल) -1-एथेनोन |
|
उत्पाद का नाम | 2-ब्रोमो-1- (3,5-डाइमिथाइल-1-बेंजोथियोफेन-2-वाईएल) -1-एथेनोन |
समानार्थी | 2-ब्रोमो -1- (3,5-डाइमिथाइल-1-बेंजोथियोफेन-2-वाईएल) एथेनोन; |
अंग्रेज | 2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)-1-ethanone;2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)ethanone |
आणविक फार्मूला | C12H11BrOS |
आण्विक वजन | 283.1841 |
InChI | InChI=1/C12H11BrOS/c1-7-3-4-11-9(5-7)8(2)12(15-11)10(14)6-13/h3-5H,6H2,1-2H3 |
कैस रजिस्टी संख्या | 388088-83-3 |
आणविक संरचना | ![]() |
घनत्व | 1.488g/cm3 |
गलनांक | 125℃ |
उबलने का समय | 378.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.655 |
फ्लैश प्वाइंट | 182.7°C |
वाष्प का दबाव | 6.26E-06mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |