ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36919-03-6 Methyl pentafluorophenyl carbonate |
|
उत्पाद का नाम | Methyl pentafluorophenyl carbonate |
अंग्रेज | Methyl pentafluorophenyl carbonate;Pentafluorophenyl methyl carbonate |
आणविक फार्मूला | C8H3F5O3 |
आण्विक वजन | 242.0996 |
InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
कैस रजिस्टी संख्या | 36919-03-6 |
आणविक संरचना | |
घनत्व | 1.567g/cm3 |
उबलने का समय | 207.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.422 |
फ्लैश प्वाइंट | 77.3°C |
वाष्प का दबाव | 0.224mmHg at 25°C |
खतरे के कोड | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |