ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35696-77-6 2,4-Dimethoxyphenylthiourea |
|
उत्पाद का नाम | 2,4-Dimethoxyphenylthiourea |
अंग्रेज | 2,4-Dimethoxyphenylthiourea;1-(2,4-DIMETHOXYPHENYL)-2-THIOUREA;1-(2,4-dimethoxyphenyl)thiourea |
आणविक फार्मूला | C9H12N2O2S |
आण्विक वजन | 212.2688 |
InChI | InChI=1/C9H12N2O2S/c1-12-6-3-4-7(11-9(10)14)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11,14) |
कैस रजिस्टी संख्या | 35696-77-6 |
आणविक संरचना | |
घनत्व | 1.282g/cm3 |
उबलने का समय | 352.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.645 |
फ्लैश प्वाइंट | 167°C |
वाष्प का दबाव | 3.83E-05mmHg at 25°C |
खतरे के कोड | R25##Toxic if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |