ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349-01-9 2,4-dinitro-5-fluorotoluene |
|
उत्पाद का नाम | 2,4-dinitro-5-fluorotoluene |
अंग्रेज | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
आणविक फार्मूला | C7H5FN2O4 |
आण्विक वजन | 200.124 |
InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
कैस रजिस्टी संख्या | 349-01-9 |
आणविक संरचना | |
घनत्व | 1.497g/cm3 |
गलनांक | 82℃ |
उबलने का समय | 319°C at 760 mmHg |
अपवर्तक सूचकांक | 1.575 |
फ्लैश प्वाइंट | 146.8°C |
वाष्प का दबाव | 0.000649mmHg at 25°C |
खतरा प्रतीक | T##Toxic:; |
खतरे के कोड | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |