ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline |
|
उत्पाद का नाम | 2-(trifluoromethylthio)aniline |
अंग्रेज | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
आणविक फार्मूला | C11H11FO4 |
आण्विक वजन | 226.201 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
कैस रजिस्टी संख्या | 347-55-7 |
EINECS | 206-473-1 |
आणविक संरचना | ![]() |
घनत्व | 1.279g/cm3 |
उबलने का समय | 422.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.52 |
फ्लैश प्वाइंट | 209.4°C |
वाष्प का दबाव | 6.78E-08mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |