ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344-14-9 dimethyl fluoromalonate |
|
उत्पाद का नाम | dimethyl fluoromalonate |
अंग्रेज | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
आणविक फार्मूला | C5H7FO4 |
आण्विक वजन | 150.1051 |
InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
कैस रजिस्टी संख्या | 344-14-9 |
आणविक संरचना | ![]() |
घनत्व | 1.211g/cm3 |
उबलने का समय | 140.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.382 |
फ्लैश प्वाइंट | 38.4°C |
वाष्प का दबाव | 6.18mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |