ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33904-04-0 3,4-Dimethoxyphenyl isothiocyanate |
|
उत्पाद का नाम | 3,4-Dimethoxyphenyl isothiocyanate |
अंग्रेज | 3,4-Dimethoxyphenyl isothiocyanate;3,4-Dimethoxyisothiocyanatobenzene;4-isothiocyanato-1,2-dimethoxybenzene |
आणविक फार्मूला | C9H9NO2S |
आण्विक वजन | 195.2383 |
InChI | InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
कैस रजिस्टी संख्या | 33904-04-0 |
आणविक संरचना | |
घनत्व | 1.12g/cm3 |
गलनांक | 47-172℃ |
उबलने का समय | 311°C at 760 mmHg |
अपवर्तक सूचकांक | 1.537 |
फ्लैश प्वाइंट | 141.9°C |
वाष्प का दबाव | 0.00106mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |