ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33904-03-9 2,4-dimethoxyphenyl isothiocyanate |
|
उत्पाद का नाम | 2,4-dimethoxyphenyl isothiocyanate |
अंग्रेज | 2,4-dimethoxyphenyl isothiocyanate; |
आणविक फार्मूला | C9H9NO2S |
आण्विक वजन | 195.2383 |
InChI | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
कैस रजिस्टी संख्या | 33904-03-9 |
आणविक संरचना | |
घनत्व | 1.12g/cm3 |
गलनांक | 51℃ |
उबलने का समय | 331°C at 760 mmHg |
अपवर्तक सूचकांक | 1.537 |
फ्लैश प्वाइंट | 154°C |
वाष्प का दबाव | 0.000308mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |