ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
(4-fluorophenylthio)acetic acid |
|
उत्पाद का नाम | (4-fluorophenylthio)acetic acid |
अंग्रेज | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
आणविक फार्मूला | C8H6FO2S |
आण्विक वजन | 185.196 |
InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
कैस रजिस्टी संख्या | 332-51-4 |
आणविक संरचना | |
गलनांक | 76-79℃ |
उबलने का समय | 315.4°C at 760 mmHg |
फ्लैश प्वाइंट | 144.5°C |
वाष्प का दबाव | 0.000185mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |