ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-43-4 1-(2-chloroethyl)-4-fluorobenzene |
|
उत्पाद का नाम | 1-(2-chloroethyl)-4-fluorobenzene |
अंग्रेज | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
आणविक फार्मूला | C8H8ClF |
आण्विक वजन | 158.6005 |
InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
कैस रजिस्टी संख्या | 332-43-4 |
EINECS | 206-364-9 |
आणविक संरचना | ![]() |
घनत्व | 1.15g/cm3 |
उबलने का समय | 204.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.501 |
फ्लैश प्वाइंट | 79.9°C |
वाष्प का दबाव | 0.373mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |