ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
330-94-9 4-(4-Fluorophenyl)-3-thiosemicarbazide |
|
उत्पाद का नाम | 4-(4-Fluorophenyl)-3-thiosemicarbazide |
अंग्रेज | 4-(4-Fluorophenyl)-3-thiosemicarbazide;N-(4-fluorophenyl)hydrazinecarbothioamide |
आणविक फार्मूला | C7H8FN3S |
आण्विक वजन | 185.2219 |
InChI | InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
कैस रजिस्टी संख्या | 330-94-9 |
आणविक संरचना | |
घनत्व | 1.418g/cm3 |
उबलने का समय | 285°C at 760 mmHg |
अपवर्तक सूचकांक | 1.696 |
फ्लैश प्वाइंट | 126.2°C |
वाष्प का दबाव | 0.00287mmHg at 25°C |
खतरे के कोड | R25##Toxic if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |