ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
320-65-0 2-fluorobenzal chloride |
|
उत्पाद का नाम | 2-fluorobenzal chloride |
अंग्रेज | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
आणविक फार्मूला | C7H5Cl2F |
आण्विक वजन | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
कैस रजिस्टी संख्या | 320-65-0 |
EINECS | 206-279-7 |
आणविक संरचना | ![]() |
घनत्व | 1.3 |
उबलने का समय | 224℃ |
खतरे के कोड | R34##Causes burns.||R36##Irritating to eyes.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |