ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2777-65-3 10-Undecynoic acid |
|
उत्पाद का नाम | 10-Undecynoic acid |
अंग्रेज | 10-Undecynoic acid; |
आणविक फार्मूला | C11H18O2 |
आण्विक वजन | 182.2594 |
InChI | InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
कैस रजिस्टी संख्या | 2777-65-3 |
EINECS | 220-471-8 |
आणविक संरचना | |
घनत्व | 0.966g/cm3 |
उबलने का समय | 297.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.468 |
फ्लैश प्वाइंट | 142.9°C |
वाष्प का दबाव | 0.000317mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |