ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride |
|
उत्पाद का नाम | 2-chloro-6-methylpyridine-4-carbonyl chloride |
अंग्रेज | 2-chloro-6-methylpyridine-4-carbonyl chloride; |
आणविक फार्मूला | C7H5Cl2NO |
आण्विक वजन | 190.0267 |
InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
कैस रजिस्टी संख्या | 26413-58-1 |
आणविक संरचना | |
घनत्व | 1.384g/cm3 |
उबलने का समय | 270.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.558 |
फ्लैश प्वाइंट | 117.3°C |
वाष्प का दबाव | 0.00688mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |