ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Acridine |
|
उत्पाद का नाम | Acridine |
अंग्रेज | Acridine;Dibenzo[b,e]pyridine |
आणविक फार्मूला | C13H9N |
आण्विक वजन | 179.2173 |
InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
कैस रजिस्टी संख्या | 260-94-6 |
EINECS | 205-971-6 |
आणविक संरचना | |
घनत्व | 1.187g/cm3 |
गलनांक | 105-110℃ |
उबलने का समय | 346.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.726 |
फ्लैश प्वाइंट | 153.8°C |
वाष्प का दबाव | 0.000113mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |