ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Norharman |
|
उत्पाद का नाम | Norharman |
अंग्रेज | Norharman;9H-Pyrido[3,4-B]Indole |
आणविक फार्मूला | C11H8N2 |
आण्विक वजन | 168.1946 |
InChI | InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
कैस रजिस्टी संख्या | 244-63-3 |
EINECS | 205-959-0 |
आणविक संरचना | |
घनत्व | 1.301g/cm3 |
गलनांक | 198-202℃ |
उबलने का समय | 391.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.784 |
फ्लैश प्वाइंट | 182.1°C |
वाष्प का दबाव | 5.62E-06mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |