ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23328-66-7 2,6-डि (ऑक्सिरान-2-यलमिथाइल) -1,2,3,5,6,7-हेक्साहाइड्रोपाइरोलो [3,4-एफ] आइसोइंडोल -1,3,5,7-टेट्राओन |
|
उत्पाद का नाम | 2,6-डि (ऑक्सिरान-2-यलमिथाइल) -1,2,3,5,6,7-हेक्साहाइड्रोपाइरोलो [3,4-एफ] आइसोइंडोल -1,3,5,7-टेट्राओन |
समानार्थी | 2,6-डि (ऑक्सिरान-2-यलमिथाइल) -1,2,3,5,6,7-हेक्साहाइड्रोपाइरोलो [3,4-एफ] आइसोइंडोल -1,3,5,7-टेट्रा; 2,6-बीआईएस (ऑक्सिरन -2-यलमिथाइल) पाइरोलो [3,4-एफ] आइसोइंडोल -1,3,5,7 (2 एच, 6 एच) -टेट्रोन; |
अंग्रेज | 2,6-di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone;2,6-Di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetra;2,6-bis(oxiran-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone |
आणविक फार्मूला | C16H12N2O6 |
आण्विक वजन | 328.2763 |
InChI | InChI=1/C16H12N2O6/c19-13-9-1-10-12(16(22)18(14(10)20)4-8-6-24-8)2-11(9)15(21)17(13)3-7-5-23-7/h1-2,7-8H,3-6H2 |
कैस रजिस्टी संख्या | 23328-66-7 |
आणविक संरचना | |
घनत्व | 1.713g/cm3 |
उबलने का समय | 570.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.725 |
फ्लैश प्वाइंट | 298.8°C |
वाष्प का दबाव | 5.04E-13mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |