ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23141-61-9 6-Methyl-5-nitroquinoline |
|
उत्पाद का नाम | 6-Methyl-5-nitroquinoline |
अंग्रेज | 6-Methyl-5-nitroquinoline;NSC 162892;6-methyl-5-nitro-isoquinoline |
आणविक फार्मूला | C10H8N2O2 |
आण्विक वजन | 188.18 |
InChI | InChI=1/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3 |
कैस रजिस्टी संख्या | 23141-61-9 |
EINECS | 245-447-4 |
आणविक संरचना | |
घनत्व | 1.298g/cm3 |
गलनांक | 117℃ |
उबलने का समय | 342.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.661 |
फ्लैश प्वाइंट | 160.9°C |
वाष्प का दबाव | 0.00015mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |