ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Phenanthridine |
|
उत्पाद का नाम | Phenanthridine |
अंग्रेज | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
आणविक फार्मूला | C13H9N |
आण्विक वजन | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
कैस रजिस्टी संख्या | 229-87-8 |
EINECS | 205-934-4 |
आणविक संरचना | |
घनत्व | 1.187g/cm3 |
गलनांक | 104-107℃ |
उबलने का समय | 340.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.726 |
फ्लैश प्वाइंट | 155.9°C |
वाष्प का दबाव | 0.000166mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |