ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
|
उत्पाद का नाम | (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
अंग्रेज | (1R,2R)-(-)-2-Benzyloxycyclohexylamine;(1R,2R)-(-)-1-Amino-2-benzyloxycyclohexane;(1R-trans)-(-)-2-(Phenylmethoxy)cyclohexanamine;(1R-trans)-2-(Phenylmethoxy)cyclohexaneamine;(1R,2R)-2-(benzyloxy)cyclohexanamine;(1R,2R)-2-phenylmethoxycyclohexan-1-amine |
आणविक फार्मूला | C13H19NO |
आण्विक वजन | 205.2961 |
InChI | InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m1/s1 |
कैस रजिस्टी संख्या | 216394-06-8 |
आणविक संरचना | ![]() |
घनत्व | 1.039g/cm3 |
उबलने का समय | 306.148°C at 760 mmHg |
अपवर्तक सूचकांक | 1.545 |
फ्लैश प्वाइंट | 133.224°C |
वाष्प का दबाव | 0.001mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |