ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene |
|
उत्पाद का नाम | 2-Acetyl-3-methylbenzo[b]thiophene |
अंग्रेज | 2-Acetyl-3-methylbenzo[b]thiophene;2-Acetyl-3-methylthianaphthene;1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one;1-(3-methyl-1-benzothiophen-6-yl)ethanone;1-(3-methyl-1-benzothiophen-2-yl)ethanone |
आणविक फार्मूला | C11H10OS |
आण्विक वजन | 190.2615 |
InChI | InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
कैस रजिस्टी संख्या | 18781-31-2 |
आणविक संरचना | |
घनत्व | 1.182g/cm3 |
गलनांक | 79℃ |
उबलने का समय | 319.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.631 |
फ्लैश प्वाइंट | 147°C |
वाष्प का दबाव | 0.000337mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |