ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18738-11-9 12-हाइड्रोक्सोलिक एसिड, 2-एमिनोइथेनॉल (1: 1) के साथ यौगिक |
|
उत्पाद का नाम | 12-हाइड्रोक्सोलिक एसिड, 2-एमिनोइथेनॉल (1: 1) के साथ यौगिक |
समानार्थी | 9-ऑक्टाडेसेनोइक एसिड, 12-हाइड्रॉक्सी-, (9Z, 12R)-, compd।2-एमिनोथेनॉल (1: 1) के साथ; 12-hydroxyoléique, avec 2-aminoéthanol रचना (1:1); रिसिनोलिक एसिड, मोनोथेनॉलमाइन-नमक; 12-हाइड्रोक्सोलिक एसिड, 2-एमिनोथेनॉल (1: 1) के साथ यौगिक; (9Z, 12R) -12-हाइड्रोक्सोक्टेक-9-एनोइक एसिड - 2-एमिनोएथेनॉल (1: 1); |
अंग्रेज | 12-hydroxyoleic acid, compound with 2-aminoethanol (1:1);9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, compd. with 2-aminoethanol (1:1);Acide 12-hydroxyoléique, compose avec 2-aminoéthanol (1:1);Ricinoleic acid, monoethanolamine-salt;12-Hydroxyoleic acid, compound with 2-aminoethanol (1:1);(9Z,12R)-12-hydroxyoctadec-9-enoic acid - 2-aminoethanol (1:1) |
आणविक फार्मूला | C20H41NO4 |
आण्विक वजन | 359.5438 |
InChI | InChI=1/C18H34O3.C2H7NO/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;3-1-2-4/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);4H,1-3H2/b12-9-;/t17-;/m1./s1 |
कैस रजिस्टी संख्या | 18738-11-9 |
EINECS | 242-546-4 |
आणविक संरचना | |
उबलने का समय | 416.4°C at 760 mmHg |
फ्लैश प्वाइंट | 219.8°C |
वाष्प का दबाव | 1.12E-08mmHg at 25°C |
MSDS |