ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18662-53-8 Nitrilotriacetic acid, trisodium salt, monohydrate |
|
उत्पाद का नाम | Nitrilotriacetic acid, trisodium salt, monohydrate |
अंग्रेज | Nitrilotriacetic acid, trisodium salt, monohydrate;Nitrilotriacetic acid trisodium salt monohydrate;Nitriloacetic acid trisodium salt monohydrate;sodium 2,2',2''-nitrilotriacetate hydrate (3:1:1);NTA-3Na monohydrate |
आणविक फार्मूला | C6H8NNa3O7 |
आण्विक वजन | 275.0995 |
InChI | InChI=1/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
कैस रजिस्टी संख्या | 18662-53-8 |
EINECS | 205-355-7 |
आणविक संरचना | ![]() |
गलनांक | 320℃ |
उबलने का समय | 498.2°C at 760 mmHg |
फ्लैश प्वाइंट | 255.1°C |
वाष्प का दबाव | 2.78E-11mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |