ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16215-21-7 Butyl 3-mercaptopropionate |
|
उत्पाद का नाम | Butyl 3-mercaptopropionate |
अंग्रेज | Butyl 3-mercaptopropionate;Propanoic acid, 3-mercapto-, butyl ester;Butyl mercaptopropionate;NSC 54830;beta-Mercaptopropionic acid, butyl ester;Propionic acid, 3-mercapto-, butyl ester;butyl 3-sulfanylpropanoate |
आणविक फार्मूला | C7H14O2S |
आण्विक वजन | 162.2499 |
InChI | InChI=1/C7H14O2S/c1-2-3-5-9-7(8)4-6-10/h10H,2-6H2,1H3 |
कैस रजिस्टी संख्या | 16215-21-7 |
EINECS | 240-343-5 |
आणविक संरचना | ![]() |
घनत्व | 1.003g/cm3 |
उबलने का समय | 216.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.458 |
फ्लैश प्वाइंट | 93.3°C |
वाष्प का दबाव | 0.136mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |