ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
15467-20-6 Nitrilotriacetic acid, disodium salt |
|
उत्पाद का नाम | Nitrilotriacetic acid, disodium salt |
अंग्रेज | Nitrilotriacetic acid, disodium salt;disodium hydrogen nitrilotriacetate;disodium [(carboxylatomethyl)(carboxymethyl)amino]acetate;2,2'-[(carboxymethyl)imino]diacetate (non-preferred name);acetate, 2,2',2''-nitrilotris-, sodium salt (1:2) |
आणविक फार्मूला | C6H6NNa2O6 |
आण्विक वजन | 234.095 |
InChI | InChI=1/C6H9NO6.2Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-3 |
कैस रजिस्टी संख्या | 15467-20-6 |
EINECS | 239-484-5 |
आणविक संरचना | ![]() |
गलनांक | 300℃ |
खतरा प्रतीक | |
खतरे के कोड | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |