ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
14922-36-2 4-Nitrophenylglyoxylic acid |
|
उत्पाद का नाम | 4-Nitrophenylglyoxylic acid |
अंग्रेज | 4-Nitrophenylglyoxylic acid;4-Nitrobenzoylformic acid;(4-nitrophenyl)(oxo)acetic acid |
आणविक फार्मूला | C8H5NO5 |
आण्विक वजन | 195.129 |
InChI | InChI=1/C8H5NO5/c10-7(8(11)12)5-1-3-6(4-2-5)9(13)14/h1-4H,(H,11,12) |
कैस रजिस्टी संख्या | 14922-36-2 |
आणविक संरचना | |
घनत्व | 1.531g/cm3 |
उबलने का समय | 381.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.613 |
फ्लैश प्वाइंट | 173.1°C |
वाष्प का दबाव | 1.67E-06mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |