ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-72-6 2-acetyl-3-methylthiophene |
|
उत्पाद का नाम | 2-acetyl-3-methylthiophene |
अंग्रेज | 2-acetyl-3-methylthiophene;1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
आणविक फार्मूला | C7H8OS |
आण्विक वजन | 140.2028 |
InChI | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
कैस रजिस्टी संख्या | 13679-72-6 |
EINECS | 237-179-1 |
आणविक संरचना | |
घनत्व | 1.106g/cm3 |
उबलने का समय | 214.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.535 |
फ्लैश प्वाइंट | 92.3°C |
वाष्प का दबाव | 0.152mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |