ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13090-86-3 बेंजोइक एसिड, 2,2', 2''-नाइट्रिलोट्रिथेनॉल (1: 1) के साथ यौगिक |
|
उत्पाद का नाम | बेंजोइक एसिड, 2,2', 2''-नाइट्रिलोट्रिथेनॉल (1: 1) के साथ यौगिक |
समानार्थी | बेंजोइक एसिड, 2,2', 2''-नाइट्रिलोट्रिथेनॉल (1: 1) के साथ यौगिक; बेंजोइक एसिड, कॉम्प।2,2', 2''-नाइट्रिलोट्रिस (इथेनॉल) (1: 1) के साथ; 2-हाइड्रॉक्सी-एन, एन-बीआईएस (2-हाइड्रॉक्सीथाइल) एथेनामिनियम बेंजोएट; |
अंग्रेज | benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate |
आणविक फार्मूला | C13H21NO5 |
आण्विक वजन | 271.3095 |
InChI | InChI=1/C7H6O2.C6H15NO3/c8-7(9)6-4-2-1-3-5-6;8-4-1-7(2-5-9)3-6-10/h1-5H,(H,8,9);8-10H,1-6H2 |
कैस रजिस्टी संख्या | 13090-86-3 |
EINECS | 236-002-5 |
आणविक संरचना | |
उबलने का समय | 518.5°C at 760 mmHg |
फ्लैश प्वाइंट | 267.4°C |
वाष्प का दबाव | 1.41E-11mmHg at 25°C |
MSDS |