ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13029-09-9 2,2'-Dibromobiphenyl |
|
उत्पाद का नाम | 2,2'-Dibromobiphenyl |
अंग्रेज | 2,2'-Dibromobiphenyl;2,2-Dibromophenyl;2,2-Dibromobiphenyl;2,2'-dibromodiphenyl;2,2'-Dibromo-1,1'-Biphenyl |
आणविक फार्मूला | C12H8Br2 |
आण्विक वजन | 311.9999 |
InChI | InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
कैस रजिस्टी संख्या | 13029-09-9 |
आणविक संरचना | |
घनत्व | 1.667g/cm3 |
गलनांक | 79℃ |
उबलने का समय | 332.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.625 |
फ्लैश प्वाइंट | 180°C |
वाष्प का दबाव | 0.000274mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |