114-33-0 N-Methylnicotinamide |
उत्पाद का नाम |
N-Methylnicotinamide |
अंग्रेज |
N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
आणविक फार्मूला |
C7H8N2O |
आण्विक वजन |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
कैस रजिस्टी संख्या |
114-33-0 |
EINECS |
204-046-4 |
आणविक संरचना |
|
घनत्व |
1.106g/cm3 |
गलनांक |
100-105℃ |
उबलने का समय |
347.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.529 |
फ्लैश प्वाइंट |
164.1°C |
वाष्प का दबाव |
5.3E-05mmHg at 25°C |
खतरा प्रतीक |
Xi##Irritant:;
|
खतरे के कोड |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
सुरक्षा विवरण |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |