ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Elaidic acid |
|
उत्पाद का नाम | Elaidic acid |
अंग्रेज | Elaidic acid;trans-9-Octadecenoic acid~trans-Oleic acid;trans-9-Octadecenic acid;(9E)-octadec-9-enoic acid |
आणविक फार्मूला | C18H34O2 |
आण्विक वजन | 282.4614 |
InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
कैस रजिस्टी संख्या | 112-79-8 |
EINECS | 204-006-6 |
आणविक संरचना | |
घनत्व | 0.899g/cm3 |
गलनांक | 43-45℃ |
उबलने का समय | 360°C at 760 mmHg |
अपवर्तक सूचकांक | 1.466 |
फ्लैश प्वाइंट | 270.1°C |
वाष्प का दबाव | 3.7E-06mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |