ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-21-7 Triethyleneglycoldiacetate |
|
उत्पाद का नाम | Triethyleneglycoldiacetate |
अंग्रेज | Triethyleneglycoldiacetate;Triethylene glycol diacetate;ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
आणविक फार्मूला | C10H18O6 |
आण्विक वजन | 234.2463 |
InChI | InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
कैस रजिस्टी संख्या | 111-21-7 |
EINECS | 203-846-0 |
आणविक संरचना | ![]() |
घनत्व | 1.098g/cm3 |
उबलने का समय | 286°C at 760 mmHg |
अपवर्तक सूचकांक | 1.432 |
फ्लैश प्वाइंट | 125.2°C |
वाष्प का दबाव | 0.00271mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |