ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-49-6 2-Methoxyethyl acetate |
|
| उत्पाद का नाम | 2-Methoxyethyl acetate |
| अंग्रेज | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate;2-Methoxy acetate |
| आणविक फार्मूला | C4H8O2S |
| आण्विक वजन | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| कैस रजिस्टी संख्या | 110-49-6 |
| EINECS | 203-772-9 |
| आणविक संरचना | ![]() |
| घनत्व | 1.072g/cm3 |
| गलनांक | -65℃ |
| उबलने का समय | 162.7°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.452 |
| फ्लैश प्वाइंट | 57.6°C |
| वाष्प का दबाव | 2.14mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| सुरक्षा विवरण | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |