ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
109-58-0 (2-एमिनोइथिल) कार्बामिक एसिड |
|
उत्पाद का नाम | (2-एमिनोइथिल) कार्बामिक एसिड |
समानार्थी | (2-एमिनोइथिल) कार्बामिक एसिड; कार्बामिक एसिड, (2-एमिनोइथिल) -; कार्बामिक एसिड, 1,2-एथेनेडियामाइन के साथ कॉम्प; कार्बामिक एसिड, एथिलीनडायमाइन के साथ कॉम्प; एथिलीनडायमाइन कार्बामेट; एचएसडीबी 2573; कार्बामिक एसिड, एन- (2-एमिनोइथिल) - |
अंग्रेज | (2-aminoethyl)carbamic acid;(2-Aminoethyl)carbamic acid;Carbamic acid, (2-aminoethyl)-;Carbamic acid, compd with 1,2-ethanediamine;Carbamic acid, compd with ethylenediamine;Ethylenediamine carbamate;HSDB 2573;Carbamic acid, N-(2-aminoethyl)- |
आणविक फार्मूला | C3H8N2O2 |
आण्विक वजन | 104.1078 |
InChI | InChI=1/C3H8N2O2/c4-1-2-5-3(6)7/h5H,1-2,4H2,(H,6,7) |
कैस रजिस्टी संख्या | 109-58-0 |
EINECS | 203-684-0 |
आणविक संरचना | |
घनत्व | 1.222g/cm3 |
अपवर्तक सूचकांक | 1.49 |
MSDS |