ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
उत्पाद का नाम | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
अंग्रेज | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
आणविक फार्मूला | C8H16O2 |
आण्विक वजन | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
कैस रजिस्टी संख्या | 105-08-8 |
EINECS | 203-268-9 |
आणविक संरचना | |
घनत्व | 1.004g/cm3 |
गलनांक | 31.5℃ |
उबलने का समय | 286.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.47 |
फ्लैश प्वाइंट | 161.1°C |
पानी की विलेयता | miscible |
वाष्प का दबाव | 0.000303mmHg at 25°C |
खतरे के कोड | R36:; |
सुरक्षा विवरण | S26||S39:; |
MSDS |