ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Diethylbenzene |
|
उत्पाद का नाम | 1,4-Diethylbenzene |
अंग्रेज | 1,4-Diethylbenzene;Benzene, 1,4-diethyl-;Benzene, p-diethyl-;HSDB 4083;p-Diethylbenzene;p-Ethylethylbenzene;butan-2-ylbenzene;PDEB |
आणविक फार्मूला | C10H14 |
आण्विक वजन | 134.2182 |
InChI | InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
कैस रजिस्टी संख्या | 105-05-5 |
EINECS | 203-265-2 |
आणविक संरचना | |
घनत्व | 0.86g/cm3 |
गलनांक | -43℃ |
उबलने का समय | 173.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.489 |
फ्लैश प्वाइंट | 46.3°C |
वाष्प का दबाव | 1.7mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |