ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
(4-Aminophenylthio)acetic acid |
|
उत्पाद का नाम | (4-Aminophenylthio)acetic acid |
अंग्रेज | (4-Aminophenylthio)acetic acid;2-(4-Aminophenylthio)acetic acid;4-Aminothiophenoxyacetic acid;[(4-aminophenyl)sulfanyl]acetic acid;[(4-aminophenyl)sulfanyl]acetate |
आणविक फार्मूला | C8H8NO2S |
आण्विक वजन | 182.2202 |
InChI | InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
कैस रजिस्टी संख्या | 104-18-7 |
EINECS | 203-182-1 |
आणविक संरचना | |
उबलने का समय | 405.3°C at 760 mmHg |
फ्लैश प्वाइंट | 198.9°C |
वाष्प का दबाव | 2.69E-07mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |