ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-94-6 4-Nitrophenyloxamic acid |
|
उत्पाद का नाम | 4-Nitrophenyloxamic acid |
अंग्रेज | 4-Nitrophenyloxamic acid;4-Nitrooxanilic acid;[(4-nitrophenyl)amino](oxo)acetic acid |
आणविक फार्मूला | C8H6N2O5 |
आण्विक वजन | 210.1436 |
InChI | InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
कैस रजिस्टी संख्या | 103-94-6 |
EINECS | 203-160-1 |
आणविक संरचना | |
घनत्व | 1.629g/cm3 |
अपवर्तक सूचकांक | 1.678 |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |