ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Tributyl phosphite |
|
उत्पाद का नाम | Tributyl phosphite |
अंग्रेज | Tributyl phosphite;Tri-n-butyl phosphite |
आणविक फार्मूला | C12H27O3P |
आण्विक वजन | 250.3147 |
InChI | InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
कैस रजिस्टी संख्या | 102-85-2 |
EINECS | 203-061-3 |
आणविक संरचना | |
गलनांक | -80℃ |
उबलने का समय | 268.1°C at 760 mmHg |
फ्लैश प्वाइंट | 121.1°C |
वाष्प का दबाव | 0.013mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R21##Harmful in contact with skin.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |