ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-38-5 3-Nitroformanilide |
|
उत्पाद का नाम | 3-Nitroformanilide |
अंग्रेज | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
आणविक फार्मूला | C7H6N2O3 |
आण्विक वजन | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
कैस रजिस्टी संख्या | 102-38-5 |
आणविक संरचना | |
घनत्व | 1.407g/cm3 |
उबलने का समय | 368.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.641 |
फ्लैश प्वाइंट | 176.7°C |
वाष्प का दबाव | 1.27E-05mmHg at 25°C |
खतरे के कोड | R20/22##Harmful by inhalation and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |