ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Phenylurethane |
|
उत्पाद का नाम | N-Phenylurethane |
अंग्रेज | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
आणविक फार्मूला | C9H11NO2 |
आण्विक वजन | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
कैस रजिस्टी संख्या | 101-99-5 |
EINECS | 202-995-9 |
आणविक संरचना | |
घनत्व | 1.136g/cm3 |
उबलने का समय | 238°C at 760 mmHg |
अपवर्तक सूचकांक | 1.558 |
फ्लैश प्वाइंट | 79.2°C |
वाष्प का दबाव | 0.0434mmHg at 25°C |
खतरे के कोड | R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |