ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-17-7 3-Chlorodiphenylamine |
|
उत्पाद का नाम | 3-Chlorodiphenylamine |
अंग्रेज | 3-Chlorodiphenylamine;Benzenamine, 3-chloro-N-phenyl-;3-chloro-N-phenylaniline;3-Chloro-N-phenyl-benzenamine;N-(3-chlorophenyl)aniline |
आणविक फार्मूला | C12H10ClN |
आण्विक वजन | 203.6675 |
InChI | InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
कैस रजिस्टी संख्या | 101-17-7 |
EINECS | 202-922-0 |
आणविक संरचना | |
घनत्व | 1.216g/cm3 |
उबलने का समय | 337.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.642 |
फ्लैश प्वाइंट | 147.4°C |
वाष्प का दबाव | 0.000102mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |