ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
m-Vinyltoluene |
|
उत्पाद का नाम | m-Vinyltoluene |
अंग्रेज | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene |
आणविक फार्मूला | C9H10 |
आण्विक वजन | 118.17 |
InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
कैस रजिस्टी संख्या | 100-80-1 |
EINECS | 202-889-2 |
आणविक संरचना | |
घनत्व | 170 |
उबलने का समय | 171℃ |
खतरे के कोड | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |