ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 4-hydroxy-3-nitrobenzoate |
|
שם המוצר | Methyl 4-hydroxy-3-nitrobenzoate |
שם אנגלי | Methyl 4-hydroxy-3-nitrobenzoate;4-Hydroxy-3-nitrobenzoic acid methyl ester;Methyl 3-nitro-4-hydroxybenzoate;4-(methoxycarbonyl)-2-nitrophenolate;3-nitro-4-hydroxymethyl benzoate |
מולקולרית פורמולה | C8H6NO5 |
משקל מולקולרי | 196.1375 |
InChl | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
מספר CAS | 99-42-3 |
EINECS | 202-755-3 |
מבנה מולקולרי | |
נקודת ההתוך | 74-76℃ |
נקודת רתיחה | 311.1°C at 760 mmHg |
נקודת הבזק | 141.9°C |
לחץ אדים | 0.000315mmHg at 25°C |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |