ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-29-6 2-Bromo-6-chloro-4-nitroaniline |
|
שם המוצר | 2-Bromo-6-chloro-4-nitroaniline |
שם אנגלי | 2-Bromo-6-chloro-4-nitroaniline;Benzenamine, 2-bromo-6-chloro-4-nitro-;NSC 88985;Aniline, 2-bromo-6-chloro-4-nitro-;2-Chloro-4-nitro-6-bromoaniline |
מולקולרית פורמולה | C6H4BrClN2O2 |
משקל מולקולרי | 251.4652 |
InChl | InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
מספר CAS | 99-29-6 |
EINECS | 202-745-9 |
מבנה מולקולרי | |
צפיפות | 1.909g/cm3 |
נקודת רתיחה | 344.7°C at 760 mmHg |
משקל סגולי | 1.677 |
נקודת הבזק | 162.3°C |
לחץ אדים | 6.47E-05mmHg at 25°C |
סיכונים קודי | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |