ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-81-7 alpha-bromostyrene |
|
שם המוצר | alpha-bromostyrene |
שם אנגלי | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene |
מולקולרית פורמולה | C8H7Br |
משקל מולקולרי | 183.0452 |
InChl | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
מספר CAS | 98-81-7 |
EINECS | 202-702-4 |
מבנה מולקולרי | |
צפיפות | 1.387g/cm3 |
נקודת ההתוך | -44℃ |
נקודת רתיחה | 212.6°C at 760 mmHg |
משקל סגולי | 1.574 |
נקודת הבזק | 98.3°C |
לחץ אדים | 0.249mmHg at 25°C |
Hazard סימנים | Xi##Irritant:; |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |